What is the molecular formula of Amylopectin?
The molecular formula of Amylopectin is C30H52O26.
When was Amylopectin first created and last modified?
Amylopectin was first created on June 24, 2005, and last modified on December 30, 2023.
What is the molecular weight of Amylopectin?
The molecular weight of Amylopectin is 828.7 g/mol.
What is the IUPAC Name of Amylopectin?
The IUPAC Name of Amylopectin is (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-6-[[(2R,3S,4R,5R,6R)-4,5-dihydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the InChIKey of Amylopectin?
The InChIKey of Amylopectin is WMGFVAGNIYUEEP-WUYNJSITSA-N.
What is the Canonical SMILES of Amylopectin?
The Canonical SMILES of Amylopectin is C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC4C(OC(C(C4O)O)CO)O)O)O)CO)O)O)O)O)O.
What is the CAS number of Amylopectin?
The CAS number of Amylopectin is 9037-22-3.
What is the XLogP3-AA value of Amylopectin?
The XLogP3-AA value of Amylopectin is -10.6.
How many hydrogen bond donor counts does Amylopectin have?
Amylopectin has 17 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Amylopectin have?
Amylopectin has 26 hydrogen bond acceptor counts.
When was Amylopectin created?
Amylopectin was created on June 24, 2005.
What is the synonym of Amylopectin?
One synonym of Amylopectin is AMYLOPECTIN 9037-22-3.
What is the role of Amylopectin in clinical trial NCT01708694?
Amylopectin is being investigated for its role in diabetes risk factors in clinical trial NCT01708694.